C14H24O3 — CID 101354312
(5S)-2,2,6,6,8,8-hexamethyl-1,3-dioxaspiro[4.5]decan-7-one (PubChem CID 101354312) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (5S)-2,2,6,6,8,8-hexamethyl-1,3-dioxaspiro[4.5]decan-7-one.
| Compound Name | (5S)-2,2,6,6,8,8-hexamethyl-1,3-dioxaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 101354312 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (5S)-2,2,6,6,8,8-hexamethyl-1,3-dioxaspiro[4.5]decan-7-one |
| SMILES | CC1(C)OC[C@@]2(CCC(C)(C)C(=O)C2(C)C)O1 |
| InChI | InChI=1S/C14H24O3/c1-11(2)7-8-14(12(3,4)10(11)15)9-16-13(5,6)17-14/h7-9H2,1-6H3/t14-/m1/s1 |
| InChIKey | XUHILHRDLDPAFP-CQSZACIVSA-N |
| XLogP | 2.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |