C26H38N6O3+2 — CID 101357209
6-[[2,6-bis(3-butylimidazol-3-ium-1-yl)pyridine-4-carbonyl]amino]hexanoic acid (PubChem CID 101357209) has the molecular formula C26H38N6O3+2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 6-[[2,6-bis(3-butylimidazol-3-ium-1-yl)pyridine-4-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[2,6-bis(3-butylimidazol-3-ium-1-yl)pyridine-4-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 101357209 |
| Molecular Formula | C26H38N6O3+2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 6-[[2,6-bis(3-butylimidazol-3-ium-1-yl)pyridine-4-carbonyl]amino]hexanoic acid |
| SMILES | CCCC[n+]1ccn(-c2cc(C(=O)NCCCCCC(=O)O)cc(-n3cc[n+](CCCC)c3)n2)c1 |
| InChI | InChI=1S/C26H36N6O3/c1-3-5-12-29-14-16-31(20-29)23-18-22(26(35)27-11-9-7-8-10-25(33)34)19-24(28-23)32-17-15-30(21-32)13-6-4-2/h14-21H,3-13H2,1-2H3/p+2 |
| InChIKey | SLXLECIEGIVSSP-UHFFFAOYSA-P |
| XLogP | 3.21 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|