C28H26O3 — CID 10136268
2-[3-ethyl-4-[2-[4-(1-phenylmethoxycyclopropyl)phenyl]ethynyl]phenyl]acetic acid (PubChem CID 10136268) has the molecular formula C28H26O3 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[3-ethyl-4-[2-[4-(1-phenylmethoxycyclopropyl)phenyl]ethynyl]phenyl]acetic acid.
| Compound Name | 2-[3-ethyl-4-[2-[4-(1-phenylmethoxycyclopropyl)phenyl]ethynyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 10136268 |
| Molecular Formula | C28H26O3 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 2-[3-ethyl-4-[2-[4-(1-phenylmethoxycyclopropyl)phenyl]ethynyl]phenyl]acetic acid |
| SMILES | CCc1cc(CC(=O)O)ccc1C#Cc1ccc(C2(OCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H26O3/c1-2-24-18-23(19-27(29)30)9-13-25(24)12-8-21-10-14-26(15-11-21)28(16-17-28)31-20-22-6-4-3-5-7-22/h3-7,9-11,13-15,18H,2,16-17,19-20H2,1H3,(H,29,30) |
| InChIKey | KBLMHYHDMDKYTC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|