C29H51N3O6 — CID 101362774
(Z)-N-[6-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-2-pyridinyl]octadec-9-enamide (PubChem CID 101362774) has the molecular formula C29H51N3O6 and a molecular weight of 537.74 g/mol. Its IUPAC name is (Z)-N-[6-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-2-pyridinyl]octadec-9-enamide.
| Compound Name | (Z)-N-[6-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-2-pyridinyl]octadec-9-enamide |
|---|---|
| PubChem CID | 101362774 |
| Molecular Formula | C29H51N3O6 |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.38 |
| IUPAC Name | (Z)-N-[6-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-2-pyridinyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Nc1cccc(NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)n1 |
| InChI | InChI=1S/C29H51N3O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-27(36)32-26-19-17-18-25(31-26)30-21-23(34)28(37)29(38)24(35)22-33/h9-10,17-19,23-24,28-29,33-35,37-38H,2-8,11-16,20-22H2,1H3,(H2,30,31,32,36)/b10-9-/t23-,24+,28+,29+/m0/s1 |
| InChIKey | LHTQVPJEKTYCNT-LFOAFVLISA-N |
| XLogP | 3.91 |
| TPSA | 155.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|