C7H10F2O2 — CID 101364301
(1S,2S,5S)-6,6-difluoro-5-methylcyclohex-3-ene-1,2-diol (PubChem CID 101364301) has the molecular formula C7H10F2O2 and a molecular weight of 164.15 g/mol. Its IUPAC name is (1S,2S,5S)-6,6-difluoro-5-methylcyclohex-3-ene-1,2-diol.
| Compound Name | (1S,2S,5S)-6,6-difluoro-5-methylcyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 101364301 |
| Molecular Formula | C7H10F2O2 |
| Molecular Weight | 164.15 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | (1S,2S,5S)-6,6-difluoro-5-methylcyclohex-3-ene-1,2-diol |
| SMILES | C[C@H]1C=C[C@H](O)[C@H](O)C1(F)F |
| InChI | InChI=1S/C7H10F2O2/c1-4-2-3-5(10)6(11)7(4,8)9/h2-6,10-11H,1H3/t4-,5-,6-/m0/s1 |
| InChIKey | BYNCGSLJRSKAHE-ZLUOBGJFSA-N |
| XLogP | 0.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|