C12H12F14O3 — CID 143625324
4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentane-1,2-diol;(E)-4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-en-1-ol (PubChem CID 143625324) has the molecular formula C12H12F14O3 and a molecular weight of 470.20 g/mol. Its IUPAC name is 4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentane-1,2-diol;(E)-4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-en-1-ol.
| Compound Name | 4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentane-1,2-diol;(E)-4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-en-1-ol |
|---|---|
| PubChem CID | 143625324 |
| Molecular Formula | C12H12F14O3 |
| Molecular Weight | 470.20 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentane-1,2-diol;(E)-4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-en-1-ol |
| SMILES | OC/C=C/C(F)(C(F)(F)F)C(F)(F)F.OCC(O)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H7F7O2.C6H5F7O/c7-4(5(8,9)10,6(11,12)13)1-3(15)2-14;7-4(2-1-3-14,5(8,9)10)6(11,12)13/h3,14-15H,1-2H2;1-2,14H,3H2/b;2-1+ |
| InChIKey | GEGHFTQHYRVBBK-WLHGVMLRSA-N |
| XLogP | 3.93 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|