C9H8F6O2 — CID 151520727
1-(1,1,2,2,3,3-hexafluoropropyl)cyclohexa-3,5-diene-1,2-diol (PubChem CID 151520727) has the molecular formula C9H8F6O2 and a molecular weight of 262.15 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3-hexafluoropropyl)cyclohexa-3,5-diene-1,2-diol.
| Compound Name | 1-(1,1,2,2,3,3-hexafluoropropyl)cyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 151520727 |
| Molecular Formula | C9H8F6O2 |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 1-(1,1,2,2,3,3-hexafluoropropyl)cyclohexa-3,5-diene-1,2-diol |
| SMILES | OC1C=CC=CC1(O)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H8F6O2/c10-6(11)8(12,13)9(14,15)7(17)4-2-1-3-5(7)16/h1-6,16-17H |
| InChIKey | PUKWLIGSQOYITM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|