C12H8F12O3 — CID 163794301
3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-ol (PubChem CID 163794301) has the molecular formula C12H8F12O3 and a molecular weight of 428.17 g/mol. Its IUPAC name is 3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 163794301 |
| Molecular Formula | C12H8F12O3 |
| Molecular Weight | 428.17 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-ol |
| SMILES | OC1C=C(C(O)(C(F)(F)F)C(F)(F)F)C=C(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C12H8F12O3/c13-9(14,15)7(26,10(16,17)18)4-1-5(3-6(25)2-4)8(27,11(19,20)21)12(22,23)24/h1-2,6,25-27H,3H2 |
| InChIKey | MZLRHJFIAULCBW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |