C9H8F6O3 — CID 147280085
5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-1,5-diene-1,4-diol (PubChem CID 147280085) has the molecular formula C9H8F6O3 and a molecular weight of 278.15 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-1,5-diene-1,4-diol.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-1,5-diene-1,4-diol |
|---|---|
| PubChem CID | 147280085 |
| Molecular Formula | C9H8F6O3 |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-1,5-diene-1,4-diol |
| SMILES | OC1=CCC(O)C(C(O)(C(F)(F)F)C(F)(F)F)=C1 |
| InChI | InChI=1S/C9H8F6O3/c10-8(11,12)7(18,9(13,14)15)5-3-4(16)1-2-6(5)17/h1,3,6,16-18H,2H2 |
| InChIKey | CSDDRZXLLXIRHX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |