C10H10F4O — CID 165415765
(1S,2R)-1-cyclopenta-1,3-dien-1-yl-2-fluoro-2-(trifluoromethyl)but-3-en-1-ol (PubChem CID 165415765) has the molecular formula C10H10F4O and a molecular weight of 222.18 g/mol. Its IUPAC name is (1S,2R)-1-cyclopenta-1,3-dien-1-yl-2-fluoro-2-(trifluoromethyl)but-3-en-1-ol.
| Compound Name | (1S,2R)-1-cyclopenta-1,3-dien-1-yl-2-fluoro-2-(trifluoromethyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 165415765 |
| Molecular Formula | C10H10F4O |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (1S,2R)-1-cyclopenta-1,3-dien-1-yl-2-fluoro-2-(trifluoromethyl)but-3-en-1-ol |
| SMILES | C=C[C@@](F)([C@@H](O)C1=CC=CC1)C(F)(F)F |
| InChI | InChI=1S/C10H10F4O/c1-2-9(11,10(12,13)14)8(15)7-5-3-4-6-7/h2-5,8,15H,1,6H2/t8-,9+/m0/s1 |
| InChIKey | LAUVLFYIMLVQQD-DTWKUNHWSA-N |
| XLogP | 2.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|