C10H11F2KO — CID 154678278
potassium (4Z,5E)-4-ethylidene-2,2-difluoro-5-prop-2-enylidenecyclopentan-1-ol (PubChem CID 154678278) has the molecular formula C10H11F2KO and a molecular weight of 224.29 g/mol. Its IUPAC name is potassium (4Z,5E)-4-ethylidene-2,2-difluoro-5-prop-2-enylidenecyclopentan-1-ol.
| Compound Name | potassium (4Z,5E)-4-ethylidene-2,2-difluoro-5-prop-2-enylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 154678278 |
| Molecular Formula | C10H11F2KO |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | potassium (4Z,5E)-4-ethylidene-2,2-difluoro-5-prop-2-enylidenecyclopentan-1-ol |
| SMILES | C=C/C=C1C(=C/C)\[CH-]C(F)(F)C\1O.[K+] |
| InChI | InChI=1S/C10H11F2O.K/c1-3-5-8-7(4-2)6-10(11,12)9(8)13;/h3-6,9,13H,1H2,2H3;/q-1;+1/b7-4-,8-5+; |
| InChIKey | ZCHFYWHPTUPTFM-QMKOBIDDSA-N |
| XLogP | -0.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|