C12H12F14O2 — CID 162201778
4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentane-1,2-diol;4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-1-ene (PubChem CID 162201778) has the molecular formula C12H12F14O2 and a molecular weight of 454.20 g/mol. Its IUPAC name is 4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentane-1,2-diol;4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-1-ene.
| Compound Name | 4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentane-1,2-diol;4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-1-ene |
|---|---|
| PubChem CID | 162201778 |
| Molecular Formula | C12H12F14O2 |
| Molecular Weight | 454.20 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentane-1,2-diol;4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-1-ene |
| SMILES | C=CCC(F)(C(F)(F)F)C(F)(F)F.OCC(O)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H7F7O2.C6H5F7/c7-4(5(8,9)10,6(11,12)13)1-3(15)2-14;1-2-3-4(7,5(8,9)10)6(11,12)13/h3,14-15H,1-2H2;2H,1,3H2 |
| InChIKey | ZRRJZXJLODWPCJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.20 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|