C7H12F2O2 — CID 102039194
(2R,3S)-1,1-difluorohept-6-ene-2,3-diol (PubChem CID 102039194) has the molecular formula C7H12F2O2 and a molecular weight of 166.17 g/mol. Its IUPAC name is (2R,3S)-1,1-difluorohept-6-ene-2,3-diol.
| Compound Name | (2R,3S)-1,1-difluorohept-6-ene-2,3-diol |
|---|---|
| PubChem CID | 102039194 |
| Molecular Formula | C7H12F2O2 |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | (2R,3S)-1,1-difluorohept-6-ene-2,3-diol |
| SMILES | C=CCC[C@H](O)[C@@H](O)C(F)F |
| InChI | InChI=1S/C7H12F2O2/c1-2-3-4-5(10)6(11)7(8)9/h2,5-7,10-11H,1,3-4H2/t5-,6+/m0/s1 |
| InChIKey | OFFBCSNAGHTWOD-NTSWFWBYSA-N |
| XLogP | 0.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|