C9H12F6O — CID 103312528
1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-ol (PubChem CID 103312528) has the molecular formula C9H12F6O and a molecular weight of 250.18 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-ol.
| Compound Name | 1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-ol |
|---|---|
| PubChem CID | 103312528 |
| Molecular Formula | C9H12F6O |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-ol |
| SMILES | C=CCCCC(O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H12F6O/c1-2-3-4-5-6(16)7(8(10,11)12)9(13,14)15/h2,6-7,16H,1,3-5H2 |
| InChIKey | PWQMOAKVCYQISQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|