C14H24F4O3 — CID 167572896
1,1-difluoro-1-(3-fluoropropoxy)hex-5-en-2-ol;1-fluoropent-4-en-1-ol (PubChem CID 167572896) has the molecular formula C14H24F4O3 and a molecular weight of 316.34 g/mol. Its IUPAC name is 1,1-difluoro-1-(3-fluoropropoxy)hex-5-en-2-ol;1-fluoropent-4-en-1-ol.
| Compound Name | 1,1-difluoro-1-(3-fluoropropoxy)hex-5-en-2-ol;1-fluoropent-4-en-1-ol |
|---|---|
| PubChem CID | 167572896 |
| Molecular Formula | C14H24F4O3 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1,1-difluoro-1-(3-fluoropropoxy)hex-5-en-2-ol;1-fluoropent-4-en-1-ol |
| SMILES | C=CCCC(O)C(F)(F)OCCCF.C=CCCC(O)F |
| InChI | InChI=1S/C9H15F3O2.C5H9FO/c1-2-3-5-8(13)9(11,12)14-7-4-6-10;1-2-3-4-5(6)7/h2,8,13H,1,3-7H2;2,5,7H,1,3-4H2 |
| InChIKey | GDLVPZLAYUATFN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|