C8H12F2O2 — CID 102030369
(1S,2S)-6,6-difluoro-5,5-dimethylcyclohex-3-ene-1,2-diol (PubChem CID 102030369) has the molecular formula C8H12F2O2 and a molecular weight of 178.18 g/mol. Its IUPAC name is (1S,2S)-6,6-difluoro-5,5-dimethylcyclohex-3-ene-1,2-diol.
| Compound Name | (1S,2S)-6,6-difluoro-5,5-dimethylcyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 102030369 |
| Molecular Formula | C8H12F2O2 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (1S,2S)-6,6-difluoro-5,5-dimethylcyclohex-3-ene-1,2-diol |
| SMILES | CC1(C)C=C[C@H](O)[C@H](O)C1(F)F |
| InChI | InChI=1S/C8H12F2O2/c1-7(2)4-3-5(11)6(12)8(7,9)10/h3-6,11-12H,1-2H3/t5-,6-/m0/s1 |
| InChIKey | MPIHZNDVKRAWPC-WDSKDSINSA-N |
| XLogP | 0.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|