C12H23NO2 — CID 101364877
(E)-N,N,3-triethyl-2-hydroxy-2-methylpent-3-enamide (PubChem CID 101364877) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is (E)-N,N,3-triethyl-2-hydroxy-2-methylpent-3-enamide.
| Compound Name | (E)-N,N,3-triethyl-2-hydroxy-2-methylpent-3-enamide |
|---|---|
| PubChem CID | 101364877 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (E)-N,N,3-triethyl-2-hydroxy-2-methylpent-3-enamide |
| SMILES | C/C=C(\CC)C(C)(O)C(=O)N(CC)CC |
| InChI | InChI=1S/C12H23NO2/c1-6-10(7-2)12(5,15)11(14)13(8-3)9-4/h6,15H,7-9H2,1-5H3/b10-6+ |
| InChIKey | IQDTUQRHQAUZRH-UXBLZVDNSA-N |
| XLogP | 1.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|