C12H21NO2 — CID 79381146
N-ethyl-N-(2-hydroxy-2-methylpropyl)hexa-2,4-dienamide (PubChem CID 79381146) has the molecular formula C12H21NO2 and a molecular weight of 211.31 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxy-2-methylpropyl)hexa-2,4-dienamide.
| Compound Name | N-ethyl-N-(2-hydroxy-2-methylpropyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 79381146 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | N-ethyl-N-(2-hydroxy-2-methylpropyl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)N(CC)CC(C)(C)O |
| InChI | InChI=1S/C12H21NO2/c1-5-7-8-9-11(14)13(6-2)10-12(3,4)15/h5,7-9,15H,6,10H2,1-4H3 |
| InChIKey | RTNTUMRZYOSELG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|