C13H16S2 — CID 101365630
1,3-bis(ethylsulfanyl)-1H-indene (PubChem CID 101365630) has the molecular formula C13H16S2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 1,3-bis(ethylsulfanyl)-1H-indene.
| Compound Name | 1,3-bis(ethylsulfanyl)-1H-indene |
|---|---|
| PubChem CID | 101365630 |
| Molecular Formula | C13H16S2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 1,3-bis(ethylsulfanyl)-1H-indene |
| SMILES | CCSC1=CC(SCC)c2ccccc21 |
| InChI | InChI=1S/C13H16S2/c1-3-14-12-9-13(15-4-2)11-8-6-5-7-10(11)12/h5-9,12H,3-4H2,1-2H3 |
| InChIKey | WGABHEORFBLZAX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |