C25H27NO7 — CID 101366802
[4-[2-[3-[2-(4-acetyloxy-3-methoxyphenyl)ethyl]-1,2-oxazol-5-yl]ethyl]-2-methoxyphenyl] acetate (PubChem CID 101366802) has the molecular formula C25H27NO7 and a molecular weight of 453.49 g/mol. Its IUPAC name is [4-[2-[3-[2-(4-acetyloxy-3-methoxyphenyl)ethyl]-1,2-oxazol-5-yl]ethyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[2-[3-[2-(4-acetyloxy-3-methoxyphenyl)ethyl]-1,2-oxazol-5-yl]ethyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 101366802 |
| Molecular Formula | C25H27NO7 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | [4-[2-[3-[2-(4-acetyloxy-3-methoxyphenyl)ethyl]-1,2-oxazol-5-yl]ethyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(CCc2cc(CCc3ccc(OC(C)=O)c(OC)c3)on2)ccc1OC(C)=O |
| InChI | InChI=1S/C25H27NO7/c1-16(27)31-22-11-7-18(13-24(22)29-3)5-9-20-15-21(33-26-20)10-6-19-8-12-23(32-17(2)28)25(14-19)30-4/h7-8,11-15H,5-6,9-10H2,1-4H3 |
| InChIKey | LPYRVEMZNWIAKS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 97.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|