C12H8ClN3 — CID 101367074
4-chloro-7-phenylpyrrolo[2,3-d]pyrimidine (PubChem CID 101367074) has the molecular formula C12H8ClN3 and a molecular weight of 229.67 g/mol. Its IUPAC name is 4-chloro-7-phenylpyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-chloro-7-phenylpyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 101367074 |
| Molecular Formula | C12H8ClN3 |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 4-chloro-7-phenylpyrrolo[2,3-d]pyrimidine |
| SMILES | Clc1ncnc2c1ccn2-c1ccccc1 |
| InChI | InChI=1S/C12H8ClN3/c13-11-10-6-7-16(12(10)15-8-14-11)9-4-2-1-3-5-9/h1-8H |
| InChIKey | QWECUUNLEUKHPG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |