C14H18O4 — CID 101367201
[(1R,7S)-9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl]methyl prop-2-enoate (PubChem CID 101367201) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is [(1R,7S)-9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl]methyl prop-2-enoate.
| Compound Name | [(1R,7S)-9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 101367201 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | [(1R,7S)-9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1C(=O)O[C@H]2C[C@@H]1C1CCCC12 |
| InChI | InChI=1S/C14H18O4/c1-2-13(15)17-7-11-10-6-12(18-14(11)16)9-5-3-4-8(9)10/h2,8-12H,1,3-7H2/t8?,9?,10-,11?,12+/m1/s1 |
| InChIKey | KGKBNFLJVYPBSN-HCZNEQIXSA-N |
| XLogP | 1.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|