About [4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate
[4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate (PubChem CID 101367521) has the molecular formula C23H22O5
and a molecular weight of 378.42 g/mol. Its IUPAC name is [4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate.
Molecular Properties
| Compound Name | [4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate |
| PubChem CID | 101367521 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate |
| SMILES | CCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(=O)oc3)cc2)cc1 |
| InChI | InChI=1S/C23H22O5/c1-2-3-4-15-26-20-10-5-17(6-11-20)18-7-12-21(13-8-18)28-23(25)19-9-14-22(24)27-16-19/h5-14,16H,2-4,15H2,1H3 |
| InChIKey | NKZXFCLWTVHMAW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate?
The IUPAC name of [4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate (CID 101367521) is [4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate.
What is the SMILES notation for [4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate?
The canonical SMILES for [4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate is CCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(=O)oc3)cc2)cc1.
What is the InChIKey of [4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate?
The InChIKey is NKZXFCLWTVHMAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O5/c1-2-3-4-15-26-20-10-5-17(6-11-20)18-7-12-21(13-8-18)28-23(25)19-9-14-22(24)27-16-19/h5-14,16H,2-4,15H2,1H3.
What are the key properties of [4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate?
[4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate has a molecular weight of 378.42 g/mol, XLogP of 5.09, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-pentoxyphenyl)phenyl] 6-oxopyran-3-carboxylate is sourced from PubChem (CID 101367521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).