About (4-pentoxyphenyl) 6-oxopyran-3-carboxylate
(4-pentoxyphenyl) 6-oxopyran-3-carboxylate (PubChem CID 86058446) has the molecular formula C17H18O5
and a molecular weight of 302.33 g/mol. Its IUPAC name is (4-pentoxyphenyl) 6-oxopyran-3-carboxylate.
Molecular Properties
| Compound Name | (4-pentoxyphenyl) 6-oxopyran-3-carboxylate |
| PubChem CID | 86058446 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (4-pentoxyphenyl) 6-oxopyran-3-carboxylate |
| SMILES | CCCCCOc1ccc(OC(=O)c2ccc(=O)oc2)cc1 |
| InChI | InChI=1S/C17H18O5/c1-2-3-4-11-20-14-6-8-15(9-7-14)22-17(19)13-5-10-16(18)21-12-13/h5-10,12H,2-4,11H2,1H3 |
| InChIKey | MAIRTJLGSZMFLV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-pentoxyphenyl) 6-oxopyran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-pentoxyphenyl) 6-oxopyran-3-carboxylate?
The IUPAC name of (4-pentoxyphenyl) 6-oxopyran-3-carboxylate (CID 86058446) is (4-pentoxyphenyl) 6-oxopyran-3-carboxylate.
What is the SMILES notation for (4-pentoxyphenyl) 6-oxopyran-3-carboxylate?
The canonical SMILES for (4-pentoxyphenyl) 6-oxopyran-3-carboxylate is CCCCCOc1ccc(OC(=O)c2ccc(=O)oc2)cc1.
What is the InChIKey of (4-pentoxyphenyl) 6-oxopyran-3-carboxylate?
The InChIKey is MAIRTJLGSZMFLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O5/c1-2-3-4-11-20-14-6-8-15(9-7-14)22-17(19)13-5-10-16(18)21-12-13/h5-10,12H,2-4,11H2,1H3.
What are the key properties of (4-pentoxyphenyl) 6-oxopyran-3-carboxylate?
(4-pentoxyphenyl) 6-oxopyran-3-carboxylate has a molecular weight of 302.33 g/mol, XLogP of 3.43, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pentoxyphenyl) 6-oxopyran-3-carboxylate is sourced from PubChem (CID 86058446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).