C16H28O3Si — CID 101368135
[(2R,3E,5E)-2-[tert-butyl(dimethyl)silyl]oxyhepta-3,5-dienyl] prop-2-enoate (PubChem CID 101368135) has the molecular formula C16H28O3Si and a molecular weight of 296.48 g/mol. Its IUPAC name is [(2R,3E,5E)-2-[tert-butyl(dimethyl)silyl]oxyhepta-3,5-dienyl] prop-2-enoate.
| Compound Name | [(2R,3E,5E)-2-[tert-butyl(dimethyl)silyl]oxyhepta-3,5-dienyl] prop-2-enoate |
|---|---|
| PubChem CID | 101368135 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | [(2R,3E,5E)-2-[tert-butyl(dimethyl)silyl]oxyhepta-3,5-dienyl] prop-2-enoate |
| SMILES | C=CC(=O)OC[C@@H](/C=C/C=C/C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O3Si/c1-8-10-11-12-14(13-18-15(17)9-2)19-20(6,7)16(3,4)5/h8-12,14H,2,13H2,1,3-7H3/b10-8+,12-11+/t14-/m1/s1 |
| InChIKey | PWBBZOFRUFYANB-QWGHKNSASA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|