C24H50O4Si2 — CID 101369327
tert-butyl (E)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]oct-2-enoate (PubChem CID 101369327) has the molecular formula C24H50O4Si2 and a molecular weight of 458.83 g/mol. Its IUPAC name is tert-butyl (E)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]oct-2-enoate.
| Compound Name | tert-butyl (E)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]oct-2-enoate |
|---|---|
| PubChem CID | 101369327 |
| Molecular Formula | C24H50O4Si2 |
| Molecular Weight | 458.83 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | tert-butyl (E)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]oct-2-enoate |
| SMILES | CCC(CC/C(=C\C(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H50O4Si2/c1-15-19(27-29(11,12)23(5,6)7)16-17-20(18-21(25)26-22(2,3)4)28-30(13,14)24(8,9)10/h18-19H,15-17H2,1-14H3/b20-18+ |
| InChIKey | ZPQAIKHYPYZZGL-CZIZESTLSA-N |
| XLogP | 7.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.83 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|