C25H52O4Si2 — CID 101369333
tert-butyl (E)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enoate (PubChem CID 101369333) has the molecular formula C25H52O4Si2 and a molecular weight of 472.86 g/mol. Its IUPAC name is tert-butyl (E)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enoate.
| Compound Name | tert-butyl (E)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enoate |
|---|---|
| PubChem CID | 101369333 |
| Molecular Formula | C25H52O4Si2 |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | tert-butyl (E)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enoate |
| SMILES | CCC(CCC/C(=C\C(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O4Si2/c1-15-20(28-30(11,12)24(5,6)7)17-16-18-21(19-22(26)27-23(2,3)4)29-31(13,14)25(8,9)10/h19-20H,15-18H2,1-14H3/b21-19+ |
| InChIKey | BZAQIIHSNBQKJK-XUTLUUPISA-N |
| XLogP | 8.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|