C17H22O2 — CID 101371052
(E,1S)-1-phenyl-4-[(3S)-4-propan-2-ylideneoxolan-3-yl]but-3-en-1-ol (PubChem CID 101371052) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (E,1S)-1-phenyl-4-[(3S)-4-propan-2-ylideneoxolan-3-yl]but-3-en-1-ol.
| Compound Name | (E,1S)-1-phenyl-4-[(3S)-4-propan-2-ylideneoxolan-3-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 101371052 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (E,1S)-1-phenyl-4-[(3S)-4-propan-2-ylideneoxolan-3-yl]but-3-en-1-ol |
| SMILES | CC(C)=C1COC[C@H]1/C=C/C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H22O2/c1-13(2)16-12-19-11-15(16)9-6-10-17(18)14-7-4-3-5-8-14/h3-9,15,17-18H,10-12H2,1-2H3/b9-6+/t15-,17+/m1/s1 |
| InChIKey | NTSJSYMNQDYULH-QDTKCAEZSA-N |
| XLogP | 3.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|