C21H21NO4 — CID 101372479
dimethyl 1-methyl-2,2-diphenyl-3H-pyrrole-3,4-dicarboxylate (PubChem CID 101372479) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is dimethyl 1-methyl-2,2-diphenyl-3H-pyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl 1-methyl-2,2-diphenyl-3H-pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101372479 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | dimethyl 1-methyl-2,2-diphenyl-3H-pyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)C1=CN(C)C(c2ccccc2)(c2ccccc2)C1C(=O)OC |
| InChI | InChI=1S/C21H21NO4/c1-22-14-17(19(23)25-2)18(20(24)26-3)21(22,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-14,18H,1-3H3 |
| InChIKey | XPXJPPYPZACSHP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |