C21H21NO4 — CID 101372480
dimethyl 1-benzyl-2-phenyl-2,3-dihydropyrrole-3,4-dicarboxylate (PubChem CID 101372480) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is dimethyl 1-benzyl-2-phenyl-2,3-dihydropyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl 1-benzyl-2-phenyl-2,3-dihydropyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101372480 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | dimethyl 1-benzyl-2-phenyl-2,3-dihydropyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)C1=CN(Cc2ccccc2)C(c2ccccc2)C1C(=O)OC |
| InChI | InChI=1S/C21H21NO4/c1-25-20(23)17-14-22(13-15-9-5-3-6-10-15)19(18(17)21(24)26-2)16-11-7-4-8-12-16/h3-12,14,18-19H,13H2,1-2H3 |
| InChIKey | IKVYSQNATJLDBV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |