C21H20FNO4 — CID 11257185
dimethyl 5-fluoro-1-methyl-2,2-diphenyl-3H-pyrrole-3,4-dicarboxylate (PubChem CID 11257185) has the molecular formula C21H20FNO4 and a molecular weight of 369.39 g/mol. Its IUPAC name is dimethyl 5-fluoro-1-methyl-2,2-diphenyl-3H-pyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl 5-fluoro-1-methyl-2,2-diphenyl-3H-pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11257185 |
| Molecular Formula | C21H20FNO4 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | dimethyl 5-fluoro-1-methyl-2,2-diphenyl-3H-pyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(F)N(C)C(c2ccccc2)(c2ccccc2)C1C(=O)OC |
| InChI | InChI=1S/C21H20FNO4/c1-23-18(22)16(19(24)26-2)17(20(25)27-3)21(23,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,17H,1-3H3 |
| InChIKey | YZXWYBGJKFJBSS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|