C20H21NO4 — CID 154723141
diethyl 3-phenyl-2,3-dihydroindolizine-1,2-dicarboxylate (PubChem CID 154723141) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is diethyl 3-phenyl-2,3-dihydroindolizine-1,2-dicarboxylate.
| Compound Name | diethyl 3-phenyl-2,3-dihydroindolizine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 154723141 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | diethyl 3-phenyl-2,3-dihydroindolizine-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1=C2C=CC=CN2C(c2ccccc2)C1C(=O)OCC |
| InChI | InChI=1S/C20H21NO4/c1-3-24-19(22)16-15-12-8-9-13-21(15)18(14-10-6-5-7-11-14)17(16)20(23)25-4-2/h5-13,17-18H,3-4H2,1-2H3 |
| InChIKey | ITSUXYBRPWGGJW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |