C22H23NO2 — CID 15981808
ethyl 1-benzyl-2-methyl-4-phenyl-4H-pyridine-3-carboxylate (PubChem CID 15981808) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is ethyl 1-benzyl-2-methyl-4-phenyl-4H-pyridine-3-carboxylate.
| Compound Name | ethyl 1-benzyl-2-methyl-4-phenyl-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 15981808 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | ethyl 1-benzyl-2-methyl-4-phenyl-4H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(Cc2ccccc2)C=CC1c1ccccc1 |
| InChI | InChI=1S/C22H23NO2/c1-3-25-22(24)21-17(2)23(16-18-10-6-4-7-11-18)15-14-20(21)19-12-8-5-9-13-19/h4-15,20H,3,16H2,1-2H3 |
| InChIKey | OYVPSJPZBMIKDM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |