C19H24INO2 — CID 15226566
ethyl (3aR,7S,7aS)-1-benzyl-7-iodo-2-methyl-3a,4,5,6,7,7a-hexahydroindole-3-carboxylate (PubChem CID 15226566) has the molecular formula C19H24INO2 and a molecular weight of 425.31 g/mol. Its IUPAC name is ethyl (3aR,7S,7aS)-1-benzyl-7-iodo-2-methyl-3a,4,5,6,7,7a-hexahydroindole-3-carboxylate.
| Compound Name | ethyl (3aR,7S,7aS)-1-benzyl-7-iodo-2-methyl-3a,4,5,6,7,7a-hexahydroindole-3-carboxylate |
|---|---|
| PubChem CID | 15226566 |
| Molecular Formula | C19H24INO2 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | ethyl (3aR,7S,7aS)-1-benzyl-7-iodo-2-methyl-3a,4,5,6,7,7a-hexahydroindole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(Cc2ccccc2)[C@H]2[C@@H]1CCC[C@@H]2I |
| InChI | InChI=1S/C19H24INO2/c1-3-23-19(22)17-13(2)21(12-14-8-5-4-6-9-14)18-15(17)10-7-11-16(18)20/h4-6,8-9,15-16,18H,3,7,10-12H2,1-2H3/t15-,16+,18+/m1/s1 |
| InChIKey | ZXTQBURRRHXSFB-RYRKJORJSA-N |
| XLogP | 4.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|