C26H25NO2 — CID 134850144
methyl 1-benzyl-2-methyl-2,5-diphenyl-3H-pyrrole-4-carboxylate (PubChem CID 134850144) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl 1-benzyl-2-methyl-2,5-diphenyl-3H-pyrrole-4-carboxylate.
| Compound Name | methyl 1-benzyl-2-methyl-2,5-diphenyl-3H-pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 134850144 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | methyl 1-benzyl-2-methyl-2,5-diphenyl-3H-pyrrole-4-carboxylate |
| SMILES | COC(=O)C1=C(c2ccccc2)N(Cc2ccccc2)C(C)(c2ccccc2)C1 |
| InChI | InChI=1S/C26H25NO2/c1-26(22-16-10-5-11-17-22)18-23(25(28)29-2)24(21-14-8-4-9-15-21)27(26)19-20-12-6-3-7-13-20/h3-17H,18-19H2,1-2H3 |
| InChIKey | VKKSZYBDCPXDCB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |