C19H23NO6 — CID 15205675
dimethyl (2S,3S,4R,5S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-5-phenylpyrrolidine-3,4-dicarboxylate (PubChem CID 15205675) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is dimethyl (2S,3S,4R,5S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-5-phenylpyrrolidine-3,4-dicarboxylate.
| Compound Name | dimethyl (2S,3S,4R,5S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-5-phenylpyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 15205675 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | dimethyl (2S,3S,4R,5S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-5-phenylpyrrolidine-3,4-dicarboxylate |
| SMILES | CCOC(=O)/C=C/[C@@H]1N[C@H](c2ccccc2)[C@H](C(=O)OC)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C19H23NO6/c1-4-26-14(21)11-10-13-15(18(22)24-2)16(19(23)25-3)17(20-13)12-8-6-5-7-9-12/h5-11,13,15-17,20H,4H2,1-3H3/b11-10+/t13-,15+,16+,17+/m0/s1 |
| InChIKey | DSKBBECTKSVXSU-CZTXFHCASA-N |
| XLogP | 1.40 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|