C31H20F12NOP — CID 101372922
[5-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]cyclopenta-1,3-dien-1-yl]-bis[3,5-bis(trifluoromethyl)phenyl]phosphane (PubChem CID 101372922) has the molecular formula C31H20F12NOP and a molecular weight of 681.46 g/mol. Its IUPAC name is [5-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]cyclopenta-1,3-dien-1-yl]-bis[3,5-bis(trifluoromethyl)phenyl]phosphane.
| Compound Name | [5-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]cyclopenta-1,3-dien-1-yl]-bis[3,5-bis(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 101372922 |
| Molecular Formula | C31H20F12NOP |
| Molecular Weight | 681.46 g/mol |
| Exact Mass | 681.11 |
| IUPAC Name | [5-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]cyclopenta-1,3-dien-1-yl]-bis[3,5-bis(trifluoromethyl)phenyl]phosphane |
| SMILES | FC(F)(F)c1cc(P(C2=CC=CC2C2=N[C@@H](Cc3ccccc3)CO2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H20F12NOP/c32-28(33,34)18-10-19(29(35,36)37)13-23(12-18)46(24-14-20(30(38,39)40)11-21(15-24)31(41,42)43)26-8-4-7-25(26)27-44-22(16-45-27)9-17-5-2-1-3-6-17/h1-8,10-15,22,25H,9,16H2/t22-,25?/m0/s1 |
| InChIKey | SHTDZFNSMOOQCY-XADRRFQNSA-N |
| XLogP | 9.30 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.46 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|