C8H17N — CID 101374933
2-ethyl-N,N-dimethylbut-1-en-1-amine (PubChem CID 101374933) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is 2-ethyl-N,N-dimethylbut-1-en-1-amine.
| Compound Name | 2-ethyl-N,N-dimethylbut-1-en-1-amine |
|---|---|
| PubChem CID | 101374933 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | 2-ethyl-N,N-dimethylbut-1-en-1-amine |
| SMILES | CCC(=CN(C)C)CC |
| InChI | InChI=1S/C8H17N/c1-5-8(6-2)7-9(3)4/h7H,5-6H2,1-4H3 |
| InChIKey | STWTXSWNOSMXLR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |