C9H16FN — CID 143551208
(Z)-4-fluoro-N,N,2-trimethyl-3-methylidenepent-1-en-1-amine (PubChem CID 143551208) has the molecular formula C9H16FN and a molecular weight of 157.23 g/mol. Its IUPAC name is (Z)-4-fluoro-N,N,2-trimethyl-3-methylidenepent-1-en-1-amine.
| Compound Name | (Z)-4-fluoro-N,N,2-trimethyl-3-methylidenepent-1-en-1-amine |
|---|---|
| PubChem CID | 143551208 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (Z)-4-fluoro-N,N,2-trimethyl-3-methylidenepent-1-en-1-amine |
| SMILES | C=C(/C(C)=C\N(C)C)C(C)F |
| InChI | InChI=1S/C9H16FN/c1-7(6-11(4)5)8(2)9(3)10/h6,9H,2H2,1,3-5H3/b7-6- |
| InChIKey | PJDZKIBUJJDDKU-SREVYHEPSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|