C13H24FN — CID 146226342
(Z)-N-(2,2-dimethylpropyl)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine (PubChem CID 146226342) has the molecular formula C13H24FN and a molecular weight of 213.34 g/mol. Its IUPAC name is (Z)-N-(2,2-dimethylpropyl)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine.
| Compound Name | (Z)-N-(2,2-dimethylpropyl)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine |
|---|---|
| PubChem CID | 146226342 |
| Molecular Formula | C13H24FN |
| Molecular Weight | 213.34 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | (Z)-N-(2,2-dimethylpropyl)-4-fluoro-N,2-dimethyl-3-methylidenepent-1-en-1-amine |
| SMILES | C=C(/C(C)=C\N(C)CC(C)(C)C)C(C)F |
| InChI | InChI=1S/C13H24FN/c1-10(11(2)12(3)14)8-15(7)9-13(4,5)6/h8,12H,2,9H2,1,3-7H3/b10-8- |
| InChIKey | FJHSJMYFSYEOCC-NTMALXAHSA-N |
| XLogP | 3.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|