C11H22N+ — CID 91447037
2,4-dimethylpenta-1,4-dienyl-ethyl-dimethylazanium (PubChem CID 91447037) has the molecular formula C11H22N+ and a molecular weight of 168.30 g/mol. Its IUPAC name is 2,4-dimethylpenta-1,4-dienyl-ethyl-dimethylazanium.
| Compound Name | 2,4-dimethylpenta-1,4-dienyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 91447037 |
| Molecular Formula | C11H22N+ |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.17 |
| IUPAC Name | 2,4-dimethylpenta-1,4-dienyl-ethyl-dimethylazanium |
| SMILES | C=C(C)CC(C)=C[N+](C)(C)CC |
| InChI | InChI=1S/C11H22N/c1-7-12(5,6)9-11(4)8-10(2)3/h9H,2,7-8H2,1,3-6H3/q+1 |
| InChIKey | RCKDQFYHSCGYJK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|