C10H20ClN — CID 134932135
3-ethylpenta-1,2-dienyl(trimethyl)azanium chloride (PubChem CID 134932135) has the molecular formula C10H20ClN and a molecular weight of 189.73 g/mol. Its IUPAC name is 3-ethylpenta-1,2-dienyl(trimethyl)azanium chloride.
| Compound Name | 3-ethylpenta-1,2-dienyl(trimethyl)azanium chloride |
|---|---|
| PubChem CID | 134932135 |
| Molecular Formula | C10H20ClN |
| Molecular Weight | 189.73 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 3-ethylpenta-1,2-dienyl(trimethyl)azanium chloride |
| SMILES | CCC(=C=C[N+](C)(C)C)CC.[Cl-] |
| InChI | InChI=1S/C10H20N.ClH/c1-6-10(7-2)8-9-11(3,4)5;/h9H,6-7H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | JTEZVPHEVPDENC-UHFFFAOYSA-M |
| XLogP | -0.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.73 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|