C12H21N — CID 123558604
2-ethyl-N-methyl-N-propylhexa-1,4,5-trien-1-amine (PubChem CID 123558604) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 2-ethyl-N-methyl-N-propylhexa-1,4,5-trien-1-amine.
| Compound Name | 2-ethyl-N-methyl-N-propylhexa-1,4,5-trien-1-amine |
|---|---|
| PubChem CID | 123558604 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 2-ethyl-N-methyl-N-propylhexa-1,4,5-trien-1-amine |
| SMILES | C=C=CCC(=CN(C)CCC)CC |
| InChI | InChI=1S/C12H21N/c1-5-8-9-12(7-3)11-13(4)10-6-2/h8,11H,1,6-7,9-10H2,2-4H3 |
| InChIKey | FQAYVFQNXPICQP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |