About CID 101380635
CID 101380635 (PubChem CID 101380635) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol.
Molecular Properties
| Compound Name | CID 101380635 |
| PubChem CID | 101380635 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | — |
| SMILES | CC(=O)OC1[C]C2CC2C(C)(C)C1 |
| InChI | InChI=1S/C11H16O2/c1-7(12)13-9-4-8-5-10(8)11(2,3)6-9/h8-10H,5-6H2,1-3H3 |
| InChIKey | OAKBBHOXBMBZKY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 101380635 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101380635?
The IUPAC name of CID 101380635 (CID 101380635) is not available.
What is the SMILES notation for CID 101380635?
The canonical SMILES for CID 101380635 is CC(=O)OC1[C]C2CC2C(C)(C)C1.
What is the InChIKey of CID 101380635?
The InChIKey is OAKBBHOXBMBZKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-7(12)13-9-4-8-5-10(8)11(2,3)6-9/h8-10H,5-6H2,1-3H3.
What are the key properties of CID 101380635?
CID 101380635 has a molecular weight of 180.25 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101380635 is sourced from PubChem (CID 101380635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).