C16H29NO4 — CID 101381520
(3aS,4R,6S,7aS)-4-ethyl-1-heptyl-6-methoxy-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazol-2-one (PubChem CID 101381520) has the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. Its IUPAC name is (3aS,4R,6S,7aS)-4-ethyl-1-heptyl-6-methoxy-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazol-2-one.
| Compound Name | (3aS,4R,6S,7aS)-4-ethyl-1-heptyl-6-methoxy-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 101381520 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | (3aS,4R,6S,7aS)-4-ethyl-1-heptyl-6-methoxy-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazol-2-one |
| SMILES | CCCCCCCN1C(=O)O[C@@H]2[C@@H](CC)O[C@H](OC)C[C@@H]21 |
| InChI | InChI=1S/C16H29NO4/c1-4-6-7-8-9-10-17-12-11-14(19-3)20-13(5-2)15(12)21-16(17)18/h12-15H,4-11H2,1-3H3/t12-,13+,14-,15-/m0/s1 |
| InChIKey | DITDVNDSKFJDMS-XGUBFFRZSA-N |
| XLogP | 3.32 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|