C29H39NO5 — CID 46863408
(3aS,6S,6aS)-3-[(4-methoxyphenyl)methyl]-6-[2-(4-octoxyphenyl)ethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-2-one (PubChem CID 46863408) has the molecular formula C29H39NO5 and a molecular weight of 481.63 g/mol. Its IUPAC name is (3aS,6S,6aS)-3-[(4-methoxyphenyl)methyl]-6-[2-(4-octoxyphenyl)ethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aS,6S,6aS)-3-[(4-methoxyphenyl)methyl]-6-[2-(4-octoxyphenyl)ethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 46863408 |
| Molecular Formula | C29H39NO5 |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | (3aS,6S,6aS)-3-[(4-methoxyphenyl)methyl]-6-[2-(4-octoxyphenyl)ethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-2-one |
| SMILES | CCCCCCCCOc1ccc(CC[C@@H]2OC[C@H]3[C@@H]2OC(=O)N3Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H39NO5/c1-3-4-5-6-7-8-19-33-25-16-9-22(10-17-25)13-18-27-28-26(21-34-27)30(29(31)35-28)20-23-11-14-24(32-2)15-12-23/h9-12,14-17,26-28H,3-8,13,18-21H2,1-2H3/t26-,27-,28-/m0/s1 |
| InChIKey | YFLBHCRPYMPBKG-KCHLEUMXSA-N |
| XLogP | 6.16 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|