C24H38F2NO6P — CID 101398190
(4S,5R)-4-(2-diethoxyphosphoryl-2,2-difluoroethyl)-5-heptyl-3-[(4-methoxyphenyl)methyl]-1,3-oxazolidin-2-one (PubChem CID 101398190) has the molecular formula C24H38F2NO6P and a molecular weight of 505.54 g/mol. Its IUPAC name is (4S,5R)-4-(2-diethoxyphosphoryl-2,2-difluoroethyl)-5-heptyl-3-[(4-methoxyphenyl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-4-(2-diethoxyphosphoryl-2,2-difluoroethyl)-5-heptyl-3-[(4-methoxyphenyl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101398190 |
| Molecular Formula | C24H38F2NO6P |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | (4S,5R)-4-(2-diethoxyphosphoryl-2,2-difluoroethyl)-5-heptyl-3-[(4-methoxyphenyl)methyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCCCC[C@H]1OC(=O)N(Cc2ccc(OC)cc2)[C@H]1CC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C24H38F2NO6P/c1-5-8-9-10-11-12-22-21(17-24(25,26)34(29,31-6-2)32-7-3)27(23(28)33-22)18-19-13-15-20(30-4)16-14-19/h13-16,21-22H,5-12,17-18H2,1-4H3/t21-,22+/m0/s1 |
| InChIKey | LPMNEZBWBJFCGM-FCHUYYIVSA-N |
| XLogP | 6.99 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|