C20H31NO3S — CID 135050504
(4S,5R)-3-(tert-butylsulfanylmethyl)-5-(4-methoxyphenyl)-4-pentyl-1,3-oxazolidin-2-one (PubChem CID 135050504) has the molecular formula C20H31NO3S and a molecular weight of 365.54 g/mol. Its IUPAC name is (4S,5R)-3-(tert-butylsulfanylmethyl)-5-(4-methoxyphenyl)-4-pentyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-(tert-butylsulfanylmethyl)-5-(4-methoxyphenyl)-4-pentyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135050504 |
| Molecular Formula | C20H31NO3S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (4S,5R)-3-(tert-butylsulfanylmethyl)-5-(4-methoxyphenyl)-4-pentyl-1,3-oxazolidin-2-one |
| SMILES | CCCCC[C@H]1[C@@H](c2ccc(OC)cc2)OC(=O)N1CSC(C)(C)C |
| InChI | InChI=1S/C20H31NO3S/c1-6-7-8-9-17-18(15-10-12-16(23-5)13-11-15)24-19(22)21(17)14-25-20(2,3)4/h10-13,17-18H,6-9,14H2,1-5H3/t17-,18+/m0/s1 |
| InChIKey | PPLCTPWMUFRPNA-ZWKOTPCHSA-N |
| XLogP | 5.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|