C20H29NO4 — CID 11791958
tert-butyl (2S,3S)-1-(4-methoxyphenyl)-4-oxo-3-pentylazetidine-2-carboxylate (PubChem CID 11791958) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl (2S,3S)-1-(4-methoxyphenyl)-4-oxo-3-pentylazetidine-2-carboxylate.
| Compound Name | tert-butyl (2S,3S)-1-(4-methoxyphenyl)-4-oxo-3-pentylazetidine-2-carboxylate |
|---|---|
| PubChem CID | 11791958 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | tert-butyl (2S,3S)-1-(4-methoxyphenyl)-4-oxo-3-pentylazetidine-2-carboxylate |
| SMILES | CCCCC[C@@H]1C(=O)N(c2ccc(OC)cc2)[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29NO4/c1-6-7-8-9-16-17(19(23)25-20(2,3)4)21(18(16)22)14-10-12-15(24-5)13-11-14/h10-13,16-17H,6-9H2,1-5H3/t16-,17-/m0/s1 |
| InChIKey | LGZMKFAPXNKRFV-IRXDYDNUSA-N |
| XLogP | 3.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|