C24H27NO6 — CID 10502489
tert-butyl (2S,3S)-3-[(4-acetyloxyphenyl)methyl]-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate (PubChem CID 10502489) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-[(4-acetyloxyphenyl)methyl]-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-[(4-acetyloxyphenyl)methyl]-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 10502489 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | tert-butyl (2S,3S)-3-[(4-acetyloxyphenyl)methyl]-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate |
| SMILES | COc1ccc(N2C(=O)[C@@H](Cc3ccc(OC(C)=O)cc3)[C@H]2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H27NO6/c1-15(26)30-19-10-6-16(7-11-19)14-20-21(23(28)31-24(2,3)4)25(22(20)27)17-8-12-18(29-5)13-9-17/h6-13,20-21H,14H2,1-5H3/t20-,21-/m0/s1 |
| InChIKey | CDCWFHCEBLVFSE-SFTDATJTSA-N |
| XLogP | 3.54 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|